C10H22ClN3O2S — CID 119668001
2-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]sulfanylacetamide;hydrochloride (PubChem CID 119668001) has the molecular formula C10H22ClN3O2S and a molecular weight of 283.82 g/mol. Its IUPAC name is 2-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]sulfanylacetamide;hydrochloride.
| Compound Name | 2-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]sulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119668001 |
| Molecular Formula | C10H22ClN3O2S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]sulfanylacetamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)CSCC(N)=O.Cl |
| InChI | InChI=1S/C10H21N3O2S.ClH/c1-2-3-4-8(5-11)13-10(15)7-16-6-9(12)14;/h8H,2-7,11H2,1H3,(H2,12,14)(H,13,15);1H |
| InChIKey | NDYHHTVKSOCOQU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |