C12H21ClN4O4 — CID 119668260
N-(1-aminohexan-2-yl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide;hydrochloride (PubChem CID 119668260) has the molecular formula C12H21ClN4O4 and a molecular weight of 320.78 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119668260 |
| Molecular Formula | C12H21ClN4O4 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)CN1C(=O)C(=O)N(C)C1=O.Cl |
| InChI | InChI=1S/C12H20N4O4.ClH/c1-3-4-5-8(6-13)14-9(17)7-16-11(19)10(18)15(2)12(16)20;/h8H,3-7,13H2,1-2H3,(H,14,17);1H |
| InChIKey | STOBAJVJCCXQOC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|