C13H21ClN4O4 — CID 119668173
N-(1-aminohexan-2-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide;hydrochloride (PubChem CID 119668173) has the molecular formula C13H21ClN4O4 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119668173 |
| Molecular Formula | C13H21ClN4O4 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(5-nitro-2-oxo-1-pyridinyl)acetamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)Cn1cc([N+](=O)[O-])ccc1=O.Cl |
| InChI | InChI=1S/C13H20N4O4.ClH/c1-2-3-4-10(7-14)15-12(18)9-16-8-11(17(20)21)5-6-13(16)19;/h5-6,8,10H,2-4,7,9,14H2,1H3,(H,15,18);1H |
| InChIKey | NDSGGYBTQLTZLU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|