C14H22ClN3O3 — CID 119667141
N-(1-aminohexan-2-yl)-2-methyl-4-nitrobenzamide;hydrochloride (PubChem CID 119667141) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-methyl-4-nitrobenzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-methyl-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119667141 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-methyl-4-nitrobenzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc([N+](=O)[O-])cc1C.Cl |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-3-4-5-11(9-15)16-14(18)13-7-6-12(17(19)20)8-10(13)2;/h6-8,11H,3-5,9,15H2,1-2H3,(H,16,18);1H |
| InChIKey | DXKIDURRIADDNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|