C12H25N3O — CID 122080965
N-(1-aminohexan-2-yl)-2-(cyclopropylmethylamino)acetamide (PubChem CID 122080965) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(cyclopropylmethylamino)acetamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-(cyclopropylmethylamino)acetamide |
|---|---|
| PubChem CID | 122080965 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(cyclopropylmethylamino)acetamide |
| SMILES | CCCCC(CN)NC(=O)CNCC1CC1 |
| InChI | InChI=1S/C12H25N3O/c1-2-3-4-11(7-13)15-12(16)9-14-8-10-5-6-10/h10-11,14H,2-9,13H2,1H3,(H,15,16) |
| InChIKey | AWGKNELTBHIXTN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |