C16H32ClN3O2 — CID 119665633
N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride (PubChem CID 119665633) has the molecular formula C16H32ClN3O2 and a molecular weight of 333.90 g/mol. Its IUPAC name is N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride.
| Compound Name | N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119665633 |
| Molecular Formula | C16H32ClN3O2 |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N-[2-(1-aminohexan-2-ylamino)-2-oxoethyl]-2-cyclohexylacetamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)CNC(=O)CC1CCCCC1.Cl |
| InChI | InChI=1S/C16H31N3O2.ClH/c1-2-3-9-14(11-17)19-16(21)12-18-15(20)10-13-7-5-4-6-8-13;/h13-14H,2-12,17H2,1H3,(H,18,20)(H,19,21);1H |
| InChIKey | CFOKBESLYOEDHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |