C11H25ClN2O3 — CID 119667872
N-(1-aminohexan-2-yl)-2-(2-methoxyethoxy)acetamide;hydrochloride (PubChem CID 119667872) has the molecular formula C11H25ClN2O3 and a molecular weight of 268.78 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(2-methoxyethoxy)acetamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-(2-methoxyethoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119667872 |
| Molecular Formula | C11H25ClN2O3 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(2-methoxyethoxy)acetamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)COCCOC.Cl |
| InChI | InChI=1S/C11H24N2O3.ClH/c1-3-4-5-10(8-12)13-11(14)9-16-7-6-15-2;/h10H,3-9,12H2,1-2H3,(H,13,14);1H |
| InChIKey | RLDNPKKSFDKKOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|