C7H17N3 — CID 130768145
1,2-dimethyl-3-(2-methylpropyl)guanidine (PubChem CID 130768145) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylpropyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 130768145 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylpropyl)guanidine |
| SMILES | C/N=C(\NC)NCC(C)C |
| InChI | InChI=1S/C7H17N3/c1-6(2)5-10-7(8-3)9-4/h6H,5H2,1-4H3,(H2,8,9,10) |
| InChIKey | UYZYTTZQZXRMOX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|