C12H28N4 — CID 110927065
1-[2-(dimethylamino)-3-ethylpentyl]-2,3-dimethylguanidine (PubChem CID 110927065) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-ethylpentyl]-2,3-dimethylguanidine.
| Compound Name | 1-[2-(dimethylamino)-3-ethylpentyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 110927065 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1-[2-(dimethylamino)-3-ethylpentyl]-2,3-dimethylguanidine |
| SMILES | CCC(CC)C(CN/C(=N/C)NC)N(C)C |
| InChI | InChI=1S/C12H28N4/c1-7-10(8-2)11(16(5)6)9-15-12(13-3)14-4/h10-11H,7-9H2,1-6H3,(H2,13,14,15) |
| InChIKey | RBNCQARZJULJQS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|