C17H38N4O — CID 111945531
1-[2-(dimethylamino)-3-ethylpentyl]-3-(4-ethoxybutyl)-2-methylguanidine (PubChem CID 111945531) has the molecular formula C17H38N4O and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-ethylpentyl]-3-(4-ethoxybutyl)-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-(4-ethoxybutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111945531 |
| Molecular Formula | C17H38N4O |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 1-[2-(dimethylamino)-3-ethylpentyl]-3-(4-ethoxybutyl)-2-methylguanidine |
| SMILES | CCOCCCCN/C(=N\C)NCC(C(CC)CC)N(C)C |
| InChI | InChI=1S/C17H38N4O/c1-7-15(8-2)16(21(5)6)14-20-17(18-4)19-12-10-11-13-22-9-3/h15-16H,7-14H2,1-6H3,(H2,18,19,20) |
| InChIKey | GMFXVHXJTLOLMZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|