C24H41N7 — CID 71215855
1-[amino-(3-methylanilino)methylidene]-2-[(cycloheptylamino)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 71215855) has the molecular formula C24H41N7 and a molecular weight of 427.64 g/mol. Its IUPAC name is 1-[amino-(3-methylanilino)methylidene]-2-[(cycloheptylamino)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[amino-(3-methylanilino)methylidene]-2-[(cycloheptylamino)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 71215855 |
| Molecular Formula | C24H41N7 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | 1-[amino-(3-methylanilino)methylidene]-2-[(cycloheptylamino)methyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1CNC(N=C(N)Nc1cccc(C)c1)=NCNC1CCCCCC1 |
| InChI | InChI=1S/C24H41N7/c1-3-31-15-9-14-22(31)17-26-24(28-18-27-20-11-6-4-5-7-12-20)30-23(25)29-21-13-8-10-19(2)16-21/h8,10,13,16,20,22,27H,3-7,9,11-12,14-15,17-18H2,1-2H3,(H4,25,26,28,29,30) |
| InChIKey | XOGFTNHJRUUEMJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|