C18H24N4O4 — CID 51971279
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)oxamide (PubChem CID 51971279) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)oxamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)oxamide |
|---|---|
| PubChem CID | 51971279 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-N'-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)oxamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)C(=O)Nc1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C18H24N4O4/c1-3-22-8-4-5-13(22)10-19-17(24)18(25)20-12-6-7-15-14(9-12)21(2)16(23)11-26-15/h6-7,9,13H,3-5,8,10-11H2,1-2H3,(H,19,24)(H,20,25)/t13-/m1/s1 |
| InChIKey | VJKWPMUKGBTMPX-CYBMUJFWSA-N |
| XLogP | 0.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|