C20H30N4O5S — CID 51973291
N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]oxamide (PubChem CID 51973291) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]oxamide.
| Compound Name | N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 51973291 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]oxamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)C(=O)Nc1ccc(OC)c(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C20H30N4O5S/c1-3-23-10-6-7-16(23)14-21-19(25)20(26)22-15-8-9-18(29-2)17(13-15)24-11-4-5-12-30(24,27)28/h8-9,13,16H,3-7,10-12,14H2,1-2H3,(H,21,25)(H,22,26)/t16-/m0/s1 |
| InChIKey | LVQZNTKFSDVMLO-INIZCTEOSA-N |
| XLogP | 1.16 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|