C20H29N3O5S — CID 45492358
N-cycloheptyl-N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]oxamide (PubChem CID 45492358) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-cycloheptyl-N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]oxamide.
| Compound Name | N-cycloheptyl-N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]oxamide |
|---|---|
| PubChem CID | 45492358 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-cycloheptyl-N'-[3-(1,1-dioxothiazinan-2-yl)-4-methoxyphenyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NC2CCCCCC2)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C20H29N3O5S/c1-28-18-11-10-16(14-17(18)23-12-6-7-13-29(23,26)27)22-20(25)19(24)21-15-8-4-2-3-5-9-15/h10-11,14-15H,2-9,12-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | HLMYLBDKXWNVDK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|