C17H25N3O4S — CID 112505703
1-cyclohexyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methoxyphenyl]urea (PubChem CID 112505703) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methoxyphenyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methoxyphenyl]urea |
|---|---|
| PubChem CID | 112505703 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-cyclohexyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methoxyphenyl]urea |
| SMILES | COc1cc(NC(=O)NC2CCCCC2)ccc1N1CCCS1(=O)=O |
| InChI | InChI=1S/C17H25N3O4S/c1-24-16-12-14(19-17(21)18-13-6-3-2-4-7-13)8-9-15(16)20-10-5-11-25(20,22)23/h8-9,12-13H,2-7,10-11H2,1H3,(H2,18,19,21) |
| InChIKey | FQIQESBHBDTOJO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |