C18H19FN2O4S — CID 112505411
N-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-2-fluorobenzamide (PubChem CID 112505411) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 112505411 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methoxyphenyl]-2-fluorobenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2F)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C18H19FN2O4S/c1-25-17-12-13(20-18(22)14-6-2-3-7-15(14)19)8-9-16(17)21-10-4-5-11-26(21,23)24/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,20,22) |
| InChIKey | YFNXRXOPVXSAMG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |