C17H17FN2O4S — CID 112505896
N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyphenyl]-2-fluorobenzamide (PubChem CID 112505896) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyphenyl]-2-fluorobenzamide.
| Compound Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 112505896 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyphenyl]-2-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2F)cc1N1CCCS1(=O)=O |
| InChI | InChI=1S/C17H17FN2O4S/c1-24-16-8-7-12(11-15(16)20-9-4-10-25(20,22)23)19-17(21)13-5-2-3-6-14(13)18/h2-3,5-8,11H,4,9-10H2,1H3,(H,19,21) |
| InChIKey | QWWUCBVMFVDRER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |