C18H21N3O4S — CID 119420115
N-(3-amino-4-methoxyphenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylbenzamide (PubChem CID 119420115) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylbenzamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 119420115 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCCS3(=O)=O)cc2C)cc1N |
| InChI | InChI=1S/C18H21N3O4S/c1-12-10-14(21-8-3-9-26(21,23)24)5-6-15(12)18(22)20-13-4-7-17(25-2)16(19)11-13/h4-7,10-11H,3,8-9,19H2,1-2H3,(H,20,22) |
| InChIKey | NPQBNIDKEFENDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|