C11H13NO5S — CID 71252082
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxybenzoic acid (PubChem CID 71252082) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxybenzoic acid.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 71252082 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxybenzoic acid |
| SMILES | COc1cc(N2CCCS2(=O)=O)ccc1C(=O)O |
| InChI | InChI=1S/C11H13NO5S/c1-17-10-7-8(3-4-9(10)11(13)14)12-5-2-6-18(12,15)16/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | HXGKDDHDJNLALM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |