C20H22N2O4S — CID 110304501
(E)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-3-phenylbut-2-enamide (PubChem CID 110304501) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (E)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 110304501 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (E)-N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-3-phenylbut-2-enamide |
| SMILES | COc1ccc(N2CCCS2(=O)=O)cc1NC(=O)/C=C(\C)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-15(16-7-4-3-5-8-16)13-20(23)21-18-14-17(9-10-19(18)26-2)22-11-6-12-27(22,24)25/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,21,23)/b15-13+ |
| InChIKey | UGAQRGGLWXTCPA-FYWRMAATSA-N |
| XLogP | 3.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|