C10H12BrNO3S — CID 170557126
2-(4-bromo-3-methoxyphenyl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 170557126) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is 2-(4-bromo-3-methoxyphenyl)-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-(4-bromo-3-methoxyphenyl)-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 170557126 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-(4-bromo-3-methoxyphenyl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | COc1cc(N2CCCS2(=O)=O)ccc1Br |
| InChI | InChI=1S/C10H12BrNO3S/c1-15-10-7-8(3-4-9(10)11)12-5-2-6-16(12,13)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | WMWACZIFUGYTAL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |