C9H11BrN2O2S — CID 82864339
2-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline (PubChem CID 82864339) has the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. Its IUPAC name is 2-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline.
| Compound Name | 2-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline |
|---|---|
| PubChem CID | 82864339 |
| Molecular Formula | C9H11BrN2O2S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 2-bromo-4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline |
| SMILES | Nc1ccc(N2CCCS2(=O)=O)cc1Br |
| InChI | InChI=1S/C9H11BrN2O2S/c10-8-6-7(2-3-9(8)11)12-4-1-5-15(12,13)14/h2-3,6H,1,4-5,11H2 |
| InChIKey | CORQWGAAGXXYDB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|