C10H13BrN2O2S — CID 104815331
4-bromo-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline (PubChem CID 104815331) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is 4-bromo-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline.
| Compound Name | 4-bromo-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline |
|---|---|
| PubChem CID | 104815331 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 4-bromo-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline |
| SMILES | Cc1cc(Br)c(N2CCCS2(=O)=O)cc1N |
| InChI | InChI=1S/C10H13BrN2O2S/c1-7-5-8(11)10(6-9(7)12)13-3-2-4-16(13,14)15/h5-6H,2-4,12H2,1H3 |
| InChIKey | JPJFFWMOIWRMSK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|