C10H13NO3S — CID 142614209
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methylphenol (PubChem CID 142614209) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methylphenol.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methylphenol |
|---|---|
| PubChem CID | 142614209 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-methylphenol |
| SMILES | Cc1ccc(N2CCCS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C10H13NO3S/c1-8-3-4-9(10(12)7-8)11-5-2-6-15(11,13)14/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | RTOFOSSPQYIVAX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |