C10H14N2O2S — CID 16642516
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylaniline (PubChem CID 16642516) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylaniline.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylaniline |
|---|---|
| PubChem CID | 16642516 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methylaniline |
| SMILES | Cc1cc(N)ccc1N1CCCS1(=O)=O |
| InChI | InChI=1S/C10H14N2O2S/c1-8-7-9(11)3-4-10(8)12-5-2-6-15(12,13)14/h3-4,7H,2,5-6,11H2,1H3 |
| InChIKey | TYIQKZTZDRTVKZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|