C10H14N2O3S — CID 63258635
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyaniline (PubChem CID 63258635) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyaniline.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 63258635 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)c(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-15-8-3-4-9(11)10(7-8)12-5-2-6-16(12,13)14/h3-4,7H,2,5-6,11H2,1H3 |
| InChIKey | DCTVKMAJVQMLJK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|