C9H13ClN2O2S — CID 171150549
4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline;hydrochloride (PubChem CID 171150549) has the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline;hydrochloride.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline;hydrochloride |
|---|---|
| PubChem CID | 171150549 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C9H12N2O2S.ClH/c10-8-2-4-9(5-3-8)11-6-1-7-14(11,12)13;/h2-5H,1,6-7,10H2;1H |
| InChIKey | XMQPLIOMOLFSLH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|