C10H12N2O3S — CID 168653690
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]formamide (PubChem CID 168653690) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]formamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 168653690 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]formamide |
| SMILES | O=CNc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C10H12N2O3S/c13-8-11-9-2-4-10(5-3-9)12-6-1-7-16(12,14)15/h2-5,8H,1,6-7H2,(H,11,13) |
| InChIKey | BQEDQASQBIRDKQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|