C11H15ClN2O4S2 — CID 7584636
1-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]methanesulfonamide (PubChem CID 7584636) has the molecular formula C11H15ClN2O4S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 7584636 |
| Molecular Formula | C11H15ClN2O4S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(CCl)Nc1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C11H15ClN2O4S2/c12-9-19(15,16)13-10-3-5-11(6-4-10)14-7-1-2-8-20(14,17)18/h3-6,13H,1-2,7-9H2 |
| InChIKey | QWVLXNWKZGUNQJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|