C15H23N3O4S2 — CID 110622880
N-(cyclopentylsulfamoyl)-4-(1,1-dioxothiazinan-2-yl)aniline (PubChem CID 110622880) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(cyclopentylsulfamoyl)-4-(1,1-dioxothiazinan-2-yl)aniline.
| Compound Name | N-(cyclopentylsulfamoyl)-4-(1,1-dioxothiazinan-2-yl)aniline |
|---|---|
| PubChem CID | 110622880 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(cyclopentylsulfamoyl)-4-(1,1-dioxothiazinan-2-yl)aniline |
| SMILES | O=S(=O)(Nc1ccc(N2CCCCS2(=O)=O)cc1)NC1CCCC1 |
| InChI | InChI=1S/C15H23N3O4S2/c19-23(20)12-4-3-11-18(23)15-9-7-14(8-10-15)17-24(21,22)16-13-5-1-2-6-13/h7-10,13,16-17H,1-6,11-12H2 |
| InChIKey | KMSBZHPJQSSGSK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |