C22H22N2O5S2 — CID 20962759
4-(1,1-dioxothiazinan-2-yl)-N-(4-phenoxyphenyl)benzenesulfonamide (PubChem CID 20962759) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-(4-phenoxyphenyl)benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-(4-phenoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20962759 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-(4-phenoxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccccc2)cc1)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N2O5S2/c25-30(26)17-5-4-16-24(30)19-10-14-22(15-11-19)31(27,28)23-18-8-12-21(13-9-18)29-20-6-2-1-3-7-20/h1-3,6-15,23H,4-5,16-17H2 |
| InChIKey | JMSOYQKJDCJKPV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |