C16H17ClN2O4S2 — CID 7584632
3-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]benzenesulfonamide (PubChem CID 7584632) has the molecular formula C16H17ClN2O4S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7584632 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 3-chloro-N-[4-(1,1-dioxothiazinan-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCCCS2(=O)=O)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O4S2/c17-13-4-3-5-16(12-13)25(22,23)18-14-6-8-15(9-7-14)19-10-1-2-11-24(19,20)21/h3-9,12,18H,1-2,10-11H2 |
| InChIKey | QIZQWCVSBBWDJU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |