C18H22N2O4S2 — CID 112505484
N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-methylbenzenesulfonamide (PubChem CID 112505484) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112505484 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(N3CCCCS3(=O)=O)c(C)c2)c1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-14-6-5-7-17(12-14)26(23,24)19-16-8-9-18(15(2)13-16)20-10-3-4-11-25(20,21)22/h5-9,12-13,19H,3-4,10-11H2,1-2H3 |
| InChIKey | PWRVVPNKXLOFOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |