C18H23N3O6S3 — CID 39776373
4-(1,1-dioxothiazinan-2-yl)-2,5-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 39776373) has the molecular formula C18H23N3O6S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-2,5-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-2,5-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39776373 |
| Molecular Formula | C18H23N3O6S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-2,5-dimethyl-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)c(C)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C18H23N3O6S3/c1-13-12-18(14(2)11-17(13)21-9-3-4-10-28(21,22)23)30(26,27)20-15-5-7-16(8-6-15)29(19,24)25/h5-8,11-12,20H,3-4,9-10H2,1-2H3,(H2,19,24,25) |
| InChIKey | SGNBNQWGGPSIGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |