C19H30N2O4S2 — CID 39776210
N-cycloheptyl-4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylbenzenesulfonamide (PubChem CID 39776210) has the molecular formula C19H30N2O4S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-cycloheptyl-4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 39776210 |
| Molecular Formula | C19H30N2O4S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-cycloheptyl-4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCCCC2)c(C)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C19H30N2O4S2/c1-15-14-19(27(24,25)20-17-9-5-3-4-6-10-17)16(2)13-18(15)21-11-7-8-12-26(21,22)23/h13-14,17,20H,3-12H2,1-2H3 |
| InChIKey | MKRULKGHAKZOSD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |