C18H28N2O5S2 — CID 39776404
N-cyclohexyl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide (PubChem CID 39776404) has the molecular formula C18H28N2O5S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-cyclohexyl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide.
| Compound Name | N-cyclohexyl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39776404 |
| Molecular Formula | C18H28N2O5S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-cyclohexyl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H28N2O5S2/c1-2-25-17-11-10-16(20-12-6-7-13-26(20,21)22)14-18(17)27(23,24)19-15-8-4-3-5-9-15/h10-11,14-15,19H,2-9,12-13H2,1H3 |
| InChIKey | LKWRKRAMARWPKW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |