C22H30N2O5S2 — CID 39776514
N-(2,6-diethylphenyl)-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide (PubChem CID 39776514) has the molecular formula C22H30N2O5S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide.
| Compound Name | N-(2,6-diethylphenyl)-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39776514 |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C22H30N2O5S2/c1-4-17-10-9-11-18(5-2)22(17)23-31(27,28)21-16-19(12-13-20(21)29-6-3)24-14-7-8-15-30(24,25)26/h9-13,16,23H,4-8,14-15H2,1-3H3 |
| InChIKey | WLRZARQMKGHMMK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |