C16H24N2O6S2 — CID 39776409
2-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide (PubChem CID 39776409) has the molecular formula C16H24N2O6S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide.
| Compound Name | 2-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 39776409 |
| Molecular Formula | C16H24N2O6S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H24N2O6S2/c1-2-24-15-6-5-14(18-7-3-4-12-25(18,19)20)13-16(15)26(21,22)17-8-10-23-11-9-17/h5-6,13H,2-4,7-12H2,1H3 |
| InChIKey | BDZXRXPSBPPGHM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |