C15H24N2O6S2 — CID 39776407
5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 39776407) has the molecular formula C15H24N2O6S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39776407 |
| Molecular Formula | C15H24N2O6S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)NCCOC |
| InChI | InChI=1S/C15H24N2O6S2/c1-3-23-14-7-6-13(17-9-4-5-11-24(17,18)19)12-15(14)25(20,21)16-8-10-22-2/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | VQYZGRIFAUPRTF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|