C16H25N3O6S2 — CID 21005642
N-[3-(dimethylamino)propyl]-2-ethoxy-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 21005642) has the molecular formula C16H25N3O6S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-ethoxy-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-ethoxy-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21005642 |
| Molecular Formula | C16H25N3O6S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-ethoxy-5-(1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(N2C(=O)CCS2(=O)=O)cc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C16H25N3O6S2/c1-4-25-14-7-6-13(19-16(20)8-11-26(19,21)22)12-15(14)27(23,24)17-9-5-10-18(2)3/h6-7,12,17H,4-5,8-11H2,1-3H3 |
| InChIKey | OPCWHTZUULTZOB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|