C19H24N2O5S2 — CID 39776497
5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 39776497) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39776497 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)-2-ethoxy-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-3-26-18-11-10-17(21-12-4-5-13-27(21,22)23)14-19(18)28(24,25)20-16-8-6-15(2)7-9-16/h6-11,14,20H,3-5,12-13H2,1-2H3 |
| InChIKey | KOMYXMMLIPFVCN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |