C16H26N2O5S2 — CID 46307101
N-butan-2-yl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide (PubChem CID 46307101) has the molecular formula C16H26N2O5S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-butan-2-yl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide.
| Compound Name | N-butan-2-yl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 46307101 |
| Molecular Formula | C16H26N2O5S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-butan-2-yl-5-(1,1-dioxothiazinan-2-yl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(N2CCCCS2(=O)=O)cc1S(=O)(=O)NC(C)CC |
| InChI | InChI=1S/C16H26N2O5S2/c1-4-13(3)17-25(21,22)16-12-14(8-9-15(16)23-5-2)18-10-6-7-11-24(18,19)20/h8-9,12-13,17H,4-7,10-11H2,1-3H3 |
| InChIKey | GTJAKDFXOIURFO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |