C13H20N2O5S2 — CID 7517083
4-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 7517083) has the molecular formula C13H20N2O5S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7517083 |
| Molecular Formula | C13H20N2O5S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C13H20N2O5S2/c1-20-10-8-14-22(18,19)13-6-4-12(5-7-13)15-9-2-3-11-21(15,16)17/h4-7,14H,2-3,8-11H2,1H3 |
| InChIKey | QVYRLGCUMBYLBJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|