C15H22N2O5S2 — CID 50797591
4-(1,1-dioxothiazinan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 50797591) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50797591 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H22N2O5S2/c18-23(19)11-2-1-9-17(23)13-5-7-15(8-6-13)24(20,21)16-12-14-4-3-10-22-14/h5-8,14,16H,1-4,9-12H2 |
| InChIKey | DTVUODZWNZKJJZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |