C17H26N2O4S2 — CID 7517162
4-(1,1-dioxothiazinan-2-yl)-N-[(1S,2R)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 7517162) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-[(1S,2R)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-[(1S,2R)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7517162 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-[(1S,2R)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C17H26N2O4S2/c1-14-6-2-3-7-17(14)18-25(22,23)16-10-8-15(9-11-16)19-12-4-5-13-24(19,20)21/h8-11,14,17-18H,2-7,12-13H2,1H3/t14-,17+/m1/s1 |
| InChIKey | MURRBNVQSKWHRF-PBHICJAKSA-N |
| XLogP | 2.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |