C14H20N2O5S2 — CID 7216463
2-(4-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide (PubChem CID 7216463) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide.
| Compound Name | 2-(4-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 7216463 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylphenyl)thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H20N2O5S2/c17-22(18)12-2-1-7-16(22)13-3-5-14(6-4-13)23(19,20)15-8-10-21-11-9-15/h3-6H,1-2,7-12H2 |
| InChIKey | JTZHPOUBSHFETF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |