C18H29N3O5S — CID 119693241
(2S)-2-amino-N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-4-methylpentanamide (PubChem CID 119693241) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 119693241 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2S)-2-amino-N-(4-ethoxy-3-morpholin-4-ylsulfonylphenyl)-4-methylpentanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](N)CC(C)C)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H29N3O5S/c1-4-26-16-6-5-14(20-18(22)15(19)11-13(2)3)12-17(16)27(23,24)21-7-9-25-10-8-21/h5-6,12-13,15H,4,7-11,19H2,1-3H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | YYKIHICGCCIIGB-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |