C17H25N3O5S2 — CID 39776053
4-[4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylphenyl]sulfonylpiperazine-1-carbaldehyde (PubChem CID 39776053) has the molecular formula C17H25N3O5S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-[4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylphenyl]sulfonylpiperazine-1-carbaldehyde.
| Compound Name | 4-[4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylphenyl]sulfonylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 39776053 |
| Molecular Formula | C17H25N3O5S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[4-(1,1-dioxothiazinan-2-yl)-2,5-dimethylphenyl]sulfonylpiperazine-1-carbaldehyde |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C=O)CC2)c(C)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C17H25N3O5S2/c1-14-12-17(27(24,25)19-8-6-18(13-21)7-9-19)15(2)11-16(14)20-5-3-4-10-26(20,22)23/h11-13H,3-10H2,1-2H3 |
| InChIKey | DLOZCLXPNUVORR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|