C17H19FN2O4S2 — CID 112505593
N-[3-(1,1-dioxothiazinan-2-yl)-4-methylphenyl]-4-fluorobenzenesulfonamide (PubChem CID 112505593) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiazinan-2-yl)-4-methylphenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-(1,1-dioxothiazinan-2-yl)-4-methylphenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 112505593 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[3-(1,1-dioxothiazinan-2-yl)-4-methylphenyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C17H19FN2O4S2/c1-13-4-7-15(12-17(13)20-10-2-3-11-25(20,21)22)19-26(23,24)16-8-5-14(18)6-9-16/h4-9,12,19H,2-3,10-11H2,1H3 |
| InChIKey | RHVLVZRZGHJGFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |