C15H15ClN2O4S2 — CID 112505889
N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]benzenesulfonamide (PubChem CID 112505889) has the molecular formula C15H15ClN2O4S2 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112505889 |
| Molecular Formula | C15H15ClN2O4S2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(N2CCCS2(=O)=O)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H15ClN2O4S2/c16-14-8-7-12(18-9-4-10-23(18,19)20)11-15(14)17-24(21,22)13-5-2-1-3-6-13/h1-3,5-8,11,17H,4,9-10H2 |
| InChIKey | FGIBEIVMMHGSFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |